sadieisreallydumb sadieisreallydumb

01-12-2020
English

contestada

Select the correct answer.
Which pronoun(s) best complete(s) the sentence?
Each of the candidates gave___ speech.
speech.
A.his or her
B. their

Select the correct answer Which pronouns best completes the sentence Each of the candidates gave speech speech Ahis or her B their class=

Respuesta :

kinlomia kinlomia

01-12-2020

Answer:

Their

Explanation:

You are talking about multiple people, therefore making it their.

Hope this helps!

:)

Answer Link

Otras preguntas

What is the equation of the line that passes through the point (5,0) and has a slope of 1

A curve has equation y=x^3_6x+1.at the point where x=2

explain how the passage of Marco polo illustrates the limitations of intercultural knowledge and understanding

Please please help me

Solve 2^10 + 2^10 = 2^n.

what is the slope of 2x-3

The perimeter of a rectangle is the sum of the lengths of its four sides.Which expression,where l=length and w=width,does not show this relationship?

How are reactants converted to products in an elementary reaction?

In a certain Algebra 2 class of 21 students, 14 of them play basketball and 9 of them play baseball. There are 3 students who play neither sport. What is the pr

cosec(6b+pi/8)=sec(2b-pi/8)