weezer010902 weezer010902

03-11-2019
Chemistry

contestada

How many moles of oxygen are required to produce 4 moles of water?

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn maizetycorn

03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles H2O

Answer Link

soniaaguirre01234 soniaaguirre01234

03-11-2019

6. How do I know? Just took the test boyy

Answer Link

Otras preguntas

A. Suspension of disbelief B. Realistic dialogue C. Short sentences D. Parallel structure

Who was the first actor to portray batman?

Which statements match Justice Black’s argument? Check all that apply. Citizens are able to represent themselves easily. Even experienced citizens need legal su

A membrane that only "lets" certain molecules in while keeping other molecules out is ___ ___.

Compare and contrast the mental illness of the narrator and her uncle in “A Servant to Servants.” How does mental illness relate to the themes of the poem? Cite

help me 0.0 and fast 0.0

Duuudeeess I need help again, i tried graphing it on a graphing calculator but it wasn't working--

This is a function? True or false

A salt solution has a concentration of 200 g/L. How many grams of salt are contained in 500 mL of this solution?

This is the process where wind, water or ice may add a layer of sediment to a landform.